C22H24ClN2O4+ — CID 9149941
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide (PubChem CID 9149941) has the molecular formula C22H24ClN2O4+ and a molecular weight of 415.90 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9149941 |
| Molecular Formula | C22H24ClN2O4+ |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)N[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H23ClN2O4/c23-18-12-16(13-20-22(18)29-15-28-20)6-7-21(26)24-19(17-4-2-1-3-5-17)14-25-8-10-27-11-9-25/h1-7,12-13,19H,8-11,14-15H2,(H,24,26)/p+1/b7-6+/t19-/m0/s1 |
| InChIKey | DPWBRFVYXLDGRD-GHOSXJJBSA-O |
| XLogP | 1.85 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|