C19H22N3O5+ — CID 9150471
(E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide (PubChem CID 9150471) has the molecular formula C19H22N3O5+ and a molecular weight of 372.40 g/mol. Its IUPAC name is (E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9150471 |
| Molecular Formula | C19H22N3O5+ |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (E)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-3-(5-nitrofuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])o1)N[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O5/c23-18(8-6-16-7-9-19(27-16)22(24)25)20-17(15-4-2-1-3-5-15)14-21-10-12-26-13-11-21/h1-9,17H,10-14H2,(H,20,23)/p+1/b8-6+/t17-/m0/s1 |
| InChIKey | YMNCIHLYGBJYDX-JKNJVXJCSA-O |
| XLogP | 0.97 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|