C24H31N2O4+ — CID 9144960
(E)-3-(3,5-dimethoxyphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide (PubChem CID 9144960) has the molecular formula C24H31N2O4+ and a molecular weight of 411.52 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9144960 |
| Molecular Formula | C24H31N2O4+ |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N[C@@H](C[NH+]2CCOCC2)c2ccc(C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-18-4-7-20(8-5-18)23(17-26-10-12-30-13-11-26)25-24(27)9-6-19-14-21(28-2)16-22(15-19)29-3/h4-9,14-16,23H,10-13,17H2,1-3H3,(H,25,27)/p+1/b9-6+/t23-/m0/s1 |
| InChIKey | VUHZHLUURQRFGS-CJHOVAGGSA-O |
| XLogP | 1.80 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|