C22H27N2O4+ — CID 9144686
methyl 4-[[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]carbamoyl]benzoate (PubChem CID 9144686) has the molecular formula C22H27N2O4+ and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl 4-[[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 9144686 |
| Molecular Formula | C22H27N2O4+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | methyl 4-[[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N[C@@H](C[NH+]2CCOCC2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-16-3-5-17(6-4-16)20(15-24-11-13-28-14-12-24)23-21(25)18-7-9-19(10-8-18)22(26)27-2/h3-10,20H,11-15H2,1-2H3,(H,23,25)/p+1/t20-/m0/s1 |
| InChIKey | ZMLCMROUSINCBW-FQEVSTJZSA-O |
| XLogP | 1.17 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |