C20H22F3N2O3+ — CID 9149566
N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 9149566) has the molecular formula C20H22F3N2O3+ and a molecular weight of 395.40 g/mol. Its IUPAC name is N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 9149566 |
| Molecular Formula | C20H22F3N2O3+ |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(N[C@@H](C[NH+]1CCOCC1)c1ccccc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O3/c21-20(22,23)28-17-8-6-16(7-9-17)19(26)24-18(15-4-2-1-3-5-15)14-25-10-12-27-13-11-25/h1-9,18H,10-14H2,(H,24,26)/p+1/t18-/m0/s1 |
| InChIKey | CALRTBHHXTVOIR-SFHVURJKSA-O |
| XLogP | 1.97 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |