C21H27N2O3S+ — CID 9150013
2-(4-methoxyphenyl)sulfanyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide (PubChem CID 9150013) has the molecular formula C21H27N2O3S+ and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfanyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)sulfanyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9150013 |
| Molecular Formula | C21H27N2O3S+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfanyl-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
| SMILES | COc1ccc(SCC(=O)N[C@@H](C[NH+]2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-25-18-7-9-19(10-8-18)27-16-21(24)22-20(17-5-3-2-4-6-17)15-23-11-13-26-14-12-23/h2-10,20H,11-16H2,1H3,(H,22,24)/p+1/t20-/m0/s1 |
| InChIKey | ZHRQHAOKRJTIRL-FQEVSTJZSA-O |
| XLogP | 1.56 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |