C20H24ClN2O3+ — CID 9148972
2-(2-chlorophenoxy)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide (PubChem CID 9148972) has the molecular formula C20H24ClN2O3+ and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 9148972 |
| Molecular Formula | C20H24ClN2O3+ |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)N[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C20H23ClN2O3/c21-17-8-4-5-9-19(17)26-15-20(24)22-18(16-6-2-1-3-7-16)14-23-10-12-25-13-11-23/h1-9,18H,10-15H2,(H,22,24)/p+1/t18-/m0/s1 |
| InChIKey | UMIQCNLHQPAVFH-SFHVURJKSA-O |
| XLogP | 1.49 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |