C22H26N3O3+ — CID 9144508
2-(2-cyanophenoxy)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide (PubChem CID 9144508) has the molecular formula C22H26N3O3+ and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 9144508 |
| Molecular Formula | C22H26N3O3+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide |
| SMILES | Cc1ccc([C@H](C[NH+]2CCOCC2)NC(=O)COc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-17-6-8-18(9-7-17)20(15-25-10-12-27-13-11-25)24-22(26)16-28-21-5-3-2-4-19(21)14-23/h2-9,20H,10-13,15-16H2,1H3,(H,24,26)/p+1/t20-/m0/s1 |
| InChIKey | KJXNGJCUTWJJQI-FQEVSTJZSA-O |
| XLogP | 1.02 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |