C21H26FN2O3+ — CID 9144554
2-(2-fluorophenoxy)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide (PubChem CID 9144554) has the molecular formula C21H26FN2O3+ and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 9144554 |
| Molecular Formula | C21H26FN2O3+ |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ium-4-ylethyl]acetamide |
| SMILES | Cc1ccc([C@@H](C[NH+]2CCOCC2)NC(=O)COc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H25FN2O3/c1-16-6-8-17(9-7-16)19(14-24-10-12-26-13-11-24)23-21(25)15-27-20-5-3-2-4-18(20)22/h2-9,19H,10-15H2,1H3,(H,23,25)/p+1/t19-/m1/s1 |
| InChIKey | QOIDLPYDMVOLTF-LJQANCHMSA-O |
| XLogP | 1.29 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |