C19H24N3O4+ — CID 9149121
N-[2-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 9149121) has the molecular formula C19H24N3O4+ and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[2-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9149121 |
| Molecular Formula | C19H24N3O4+ |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[2-[[(1R)-2-morpholin-4-ium-4-yl-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)N[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O4/c23-18(13-20-19(24)17-7-4-10-26-17)21-16(15-5-2-1-3-6-15)14-22-8-11-25-12-9-22/h1-7,10,16H,8-9,11-14H2,(H,20,24)(H,21,23)/p+1/t16-/m0/s1 |
| InChIKey | XYTGHKUGISIOEO-INIZCTEOSA-O |
| XLogP | -0.22 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |