C11H17N2O3+ — CID 7720034
N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide (PubChem CID 7720034) has the molecular formula C11H17N2O3+ and a molecular weight of 225.27 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 7720034 |
| Molecular Formula | C11H17N2O3+ |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1ccco1 |
| InChI | InChI=1S/C11H16N2O3/c14-11(10-2-1-7-16-10)12-3-4-13-5-8-15-9-6-13/h1-2,7H,3-6,8-9H2,(H,12,14)/p+1 |
| InChIKey | FZCSNGBRUCTKMS-UHFFFAOYSA-O |
| XLogP | -1.08 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |