C14H21ClN2O2 — CID 43834667
2-methyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide chloride (PubChem CID 43834667) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-methyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide chloride.
| Compound Name | 2-methyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide chloride |
|---|---|
| PubChem CID | 43834667 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-methyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide chloride |
| SMILES | Cc1ccccc1C(=O)NCC[NH+]1CCOCC1.[Cl-] |
| InChI | InChI=1S/C14H20N2O2.ClH/c1-12-4-2-3-5-13(12)14(17)15-6-7-16-8-10-18-11-9-16;/h2-5H,6-11H2,1H3,(H,15,17);1H |
| InChIKey | OIGFDPMLIJWCAK-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |