C21H26N3O4+ — CID 7155155
2-[(4-methoxybenzoyl)amino]-N-(2-morpholin-4-ium-4-ylethyl)benzamide (PubChem CID 7155155) has the molecular formula C21H26N3O4+ and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)amino]-N-(2-morpholin-4-ium-4-ylethyl)benzamide.
| Compound Name | 2-[(4-methoxybenzoyl)amino]-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 7155155 |
| Molecular Formula | C21H26N3O4+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[(4-methoxybenzoyl)amino]-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-17-8-6-16(7-9-17)20(25)23-19-5-3-2-4-18(19)21(26)22-10-11-24-12-14-28-15-13-24/h2-9H,10-15H2,1H3,(H,22,26)(H,23,25)/p+1 |
| InChIKey | PNZPFZJHVCAYFI-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |