C23H26N3O4+ — CID 8781761
N-[2-(3-morpholin-4-ium-4-ylpropylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 8781761) has the molecular formula C23H26N3O4+ and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[2-(3-morpholin-4-ium-4-ylpropylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(3-morpholin-4-ium-4-ylpropylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8781761 |
| Molecular Formula | C23H26N3O4+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[2-(3-morpholin-4-ium-4-ylpropylcarbamoyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCC[NH+]1CCOCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H25N3O4/c27-22(24-10-5-11-26-12-14-29-15-13-26)18-7-2-3-8-19(18)25-23(28)21-16-17-6-1-4-9-20(17)30-21/h1-4,6-9,16H,5,10-15H2,(H,24,27)(H,25,28)/p+1 |
| InChIKey | YDRRPUASJCAAHF-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|