C12H12INO2 — CID 114504013
N-(3-iodopropyl)-1-benzofuran-2-carboxamide (PubChem CID 114504013) has the molecular formula C12H12INO2 and a molecular weight of 329.14 g/mol. Its IUPAC name is N-(3-iodopropyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-iodopropyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 114504013 |
| Molecular Formula | C12H12INO2 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | N-(3-iodopropyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCCI)c1cc2ccccc2o1 |
| InChI | InChI=1S/C12H12INO2/c13-6-3-7-14-12(15)11-8-9-4-1-2-5-10(9)16-11/h1-2,4-5,8H,3,6-7H2,(H,14,15) |
| InChIKey | UCSYMUWZZCCMDH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|