C12H9NO2 — CID 60646228
N-prop-2-ynyl-1-benzofuran-2-carboxamide (PubChem CID 60646228) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is N-prop-2-ynyl-1-benzofuran-2-carboxamide.
| Compound Name | N-prop-2-ynyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 60646228 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-prop-2-ynyl-1-benzofuran-2-carboxamide |
| SMILES | C#CCNC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C12H9NO2/c1-2-7-13-12(14)11-8-9-5-3-4-6-10(9)15-11/h1,3-6,8H,7H2,(H,13,14) |
| InChIKey | WBAQPNIPWJLEQF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|