C21H18N2O3 — CID 90550119
N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-1-benzofuran-2-carboxamide (PubChem CID 90550119) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 90550119 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[3-[4-(dimethylcarbamoyl)phenyl]prop-2-ynyl]-1-benzofuran-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(C#CCNC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H18N2O3/c1-23(2)21(25)16-11-9-15(10-12-16)6-5-13-22-20(24)19-14-17-7-3-4-8-18(17)26-19/h3-4,7-12,14H,13H2,1-2H3,(H,22,24) |
| InChIKey | JBAQNRBUGWVXBZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|