C22H21N3O2 — CID 90549934
4-[3-[(2-indol-1-ylacetyl)amino]prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 90549934) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[3-[(2-indol-1-ylacetyl)amino]prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[(2-indol-1-ylacetyl)amino]prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90549934 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[3-[(2-indol-1-ylacetyl)amino]prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C#CCNC(=O)Cn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C22H21N3O2/c1-24(2)22(27)19-11-9-17(10-12-19)6-5-14-23-21(26)16-25-15-13-18-7-3-4-8-20(18)25/h3-4,7-13,15H,14,16H2,1-2H3,(H,23,26) |
| InChIKey | OOMLHDSJQSYGRR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|