C21H22N6O4 — CID 90550156
4-[3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 90550156) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-[3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90550156 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-[3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C#CCNC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C21H22N6O4/c1-24(2)19(29)15-9-7-14(8-10-15)6-5-11-22-16(28)12-27-13-23-18-17(27)20(30)26(4)21(31)25(18)3/h7-10,13H,11-12H2,1-4H3,(H,22,28) |
| InChIKey | ZGWIQCUWWHTWKC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|