C25H29N5O3 — CID 161164511
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,2-diphenylpropyl)acetamide;methane (PubChem CID 161164511) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,2-diphenylpropyl)acetamide;methane.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,2-diphenylpropyl)acetamide;methane |
|---|---|
| PubChem CID | 161164511 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,2-diphenylpropyl)acetamide;methane |
| SMILES | C.Cn1c(=O)c2c(ncn2CC(=O)NCC(C)(c2ccccc2)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C24H25N5O3.CH4/c1-24(17-10-6-4-7-11-17,18-12-8-5-9-13-18)15-25-19(30)14-29-16-26-21-20(29)22(31)28(3)23(32)27(21)2;/h4-13,16H,14-15H2,1-3H3,(H,25,30);1H4 |
| InChIKey | UQIQODWNMRHXLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |