C17H17N5O4 — CID 16567061
N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-phenylacetamide (PubChem CID 16567061) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-phenylacetamide.
| Compound Name | N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16567061 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-phenylacetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)NC(=O)Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C17H17N5O4/c1-20-15-14(16(25)21(2)17(20)26)22(10-18-15)9-13(24)19-12(23)8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,19,23,24) |
| InChIKey | YHZYUOFVIRUSEU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |