C22H21N5O3 — CID 41221076
N-benzyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide (PubChem CID 41221076) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-benzyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide.
| Compound Name | N-benzyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 41221076 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-benzyl-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N(Cc2ccccc2)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C22H21N5O3/c1-24-20-19(21(29)25(2)22(24)30)26(15-23-20)14-18(28)27(17-11-7-4-8-12-17)13-16-9-5-3-6-10-16/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | LDEXHBFJMVZELV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |