C21H18N4O4 — CID 38833556
1,3-dimethyl-7-[2-oxo-2-(4-phenoxyphenyl)ethyl]purine-2,6-dione (PubChem CID 38833556) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-oxo-2-(4-phenoxyphenyl)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-oxo-2-(4-phenoxyphenyl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 38833556 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1,3-dimethyl-7-[2-oxo-2-(4-phenoxyphenyl)ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)c2ccc(Oc3ccccc3)cc2)n(C)c1=O |
| InChI | InChI=1S/C21H18N4O4/c1-23-19-18(20(27)24(2)21(23)28)25(13-22-19)12-17(26)14-8-10-16(11-9-14)29-15-6-4-3-5-7-15/h3-11,13H,12H2,1-2H3 |
| InChIKey | DZCFLJCDFBQJDA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |