C22H28N4O4 — CID 10835498
7-[8-(4-methoxyphenyl)-8-oxooctyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 10835498) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 7-[8-(4-methoxyphenyl)-8-oxooctyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[8-(4-methoxyphenyl)-8-oxooctyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 10835498 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 7-[8-(4-methoxyphenyl)-8-oxooctyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(C(=O)CCCCCCCn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-24-20-19(21(28)25(2)22(24)29)26(15-23-20)14-8-6-4-5-7-9-18(27)16-10-12-17(30-3)13-11-16/h10-13,15H,4-9,14H2,1-3H3 |
| InChIKey | VGMQPZOYXPOEOR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|