C20H25N5O5 — CID 33103949
N-[(2,5-dimethoxyphenyl)methyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 33103949) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 33103949 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | COc1ccc(OC)c(CNC(=O)CCCn2cnc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C20H25N5O5/c1-23-18-17(19(27)24(2)20(23)28)25(12-22-18)9-5-6-16(26)21-11-13-10-14(29-3)7-8-15(13)30-4/h7-8,10,12H,5-6,9,11H2,1-4H3,(H,21,26) |
| InChIKey | FOAZGRJKPIECSO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anisol_A(5)', 'substructure': 'N/A'} |
|---|