C15H15ClN4O3 — CID 736493
7-[(2-chloro-5-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 736493) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is 7-[(2-chloro-5-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2-chloro-5-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 736493 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 7-[(2-chloro-5-methoxyphenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(Cl)c(Cn2cnc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C15H15ClN4O3/c1-18-13-12(14(21)19(2)15(18)22)20(8-17-13)7-9-6-10(23-3)4-5-11(9)16/h4-6,8H,7H2,1-3H3 |
| InChIKey | FFJZCXRZYYSMKB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |