C21H28ClN5O3 — CID 4007494
7-[(2-chloro-5-methoxyphenyl)methyl]-8-(hexylamino)-1,3-dimethylpurine-2,6-dione (PubChem CID 4007494) has the molecular formula C21H28ClN5O3 and a molecular weight of 433.94 g/mol. Its IUPAC name is 7-[(2-chloro-5-methoxyphenyl)methyl]-8-(hexylamino)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2-chloro-5-methoxyphenyl)methyl]-8-(hexylamino)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4007494 |
| Molecular Formula | C21H28ClN5O3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 7-[(2-chloro-5-methoxyphenyl)methyl]-8-(hexylamino)-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCCCNc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1cc(OC)ccc1Cl |
| InChI | InChI=1S/C21H28ClN5O3/c1-5-6-7-8-11-23-20-24-18-17(19(28)26(3)21(29)25(18)2)27(20)13-14-12-15(30-4)9-10-16(14)22/h9-10,12H,5-8,11,13H2,1-4H3,(H,23,24) |
| InChIKey | BMTYBNKWARNRGT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|