C24H25Cl2N5O2 — CID 71029597
7-[(2,5-dichlorophenyl)methyl]-1,3-dimethyl-8-(4-phenylbutylamino)purine-2,6-dione (PubChem CID 71029597) has the molecular formula C24H25Cl2N5O2 and a molecular weight of 486.40 g/mol. Its IUPAC name is 7-[(2,5-dichlorophenyl)methyl]-1,3-dimethyl-8-(4-phenylbutylamino)purine-2,6-dione.
| Compound Name | 7-[(2,5-dichlorophenyl)methyl]-1,3-dimethyl-8-(4-phenylbutylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 71029597 |
| Molecular Formula | C24H25Cl2N5O2 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 7-[(2,5-dichlorophenyl)methyl]-1,3-dimethyl-8-(4-phenylbutylamino)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCCCc3ccccc3)n2Cc2cc(Cl)ccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C24H25Cl2N5O2/c1-29-21-20(22(32)30(2)24(29)33)31(15-17-14-18(25)11-12-19(17)26)23(28-21)27-13-7-6-10-16-8-4-3-5-9-16/h3-5,8-9,11-12,14H,6-7,10,13,15H2,1-2H3,(H,27,28) |
| InChIKey | JKIASABGQCOZQO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|