C20H26ClN5O3 — CID 3660868
7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione (PubChem CID 3660868) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is 7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione.
| Compound Name | 7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 3660868 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-propan-2-yloxypropylamino)purine-2,6-dione |
| SMILES | CC(C)OCCCNc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H26ClN5O3/c1-13(2)29-10-6-9-22-19-23-17-16(18(27)25(4)20(28)24(17)3)26(19)12-14-7-5-8-15(21)11-14/h5,7-8,11,13H,6,9-10,12H2,1-4H3,(H,22,23) |
| InChIKey | JBDPOUOCAYRNNV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|