C21H27ClN6O3 — CID 663234
7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione (PubChem CID 663234) has the molecular formula C21H27ClN6O3 and a molecular weight of 446.94 g/mol. Its IUPAC name is 7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione.
| Compound Name | 7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 663234 |
| Molecular Formula | C21H27ClN6O3 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 7-[(3-chlorophenyl)methyl]-1,3-dimethyl-8-(3-morpholin-4-ylpropylamino)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCCN3CCOCC3)n2Cc2cccc(Cl)c2)n(C)c1=O |
| InChI | InChI=1S/C21H27ClN6O3/c1-25-18-17(19(29)26(2)21(25)30)28(14-15-5-3-6-16(22)13-15)20(24-18)23-7-4-8-27-9-11-31-12-10-27/h3,5-6,13H,4,7-12,14H2,1-2H3,(H,23,24) |
| InChIKey | FVQABJLUFQZCMU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|