C25H34ClN7O3 — CID 118724648
7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione (PubChem CID 118724648) has the molecular formula C25H34ClN7O3 and a molecular weight of 516.05 g/mol. Its IUPAC name is 7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione.
| Compound Name | 7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 118724648 |
| Molecular Formula | C25H34ClN7O3 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 7-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-1,3-dimethyl-8-morpholin-4-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCOCC3)n2CCCCN2CCN(c3cccc(Cl)c3)CC2)n(C)c1=O |
| InChI | InChI=1S/C25H34ClN7O3/c1-28-22-21(23(34)29(2)25(28)35)33(24(27-22)32-14-16-36-17-15-32)9-4-3-8-30-10-12-31(13-11-30)20-7-5-6-19(26)18-20/h5-7,18H,3-4,8-17H2,1-2H3 |
| InChIKey | ZWMTZLZDXWYVBT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|