C25H29Cl2N7O3 — CID 118736401
9-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-1,3-dimethylpurino[7,8-a]pyrimidine-2,4,8-trione (PubChem CID 118736401) has the molecular formula C25H29Cl2N7O3 and a molecular weight of 546.46 g/mol. Its IUPAC name is 9-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-1,3-dimethylpurino[7,8-a]pyrimidine-2,4,8-trione.
| Compound Name | 9-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-1,3-dimethylpurino[7,8-a]pyrimidine-2,4,8-trione |
|---|---|
| PubChem CID | 118736401 |
| Molecular Formula | C25H29Cl2N7O3 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 9-[5-[4-(3,4-dichlorophenyl)piperazin-1-yl]pentyl]-1,3-dimethylpurino[7,8-a]pyrimidine-2,4,8-trione |
| SMILES | Cn1c(=O)c2c(nc3n(CCCCCN4CCN(c5ccc(Cl)c(Cl)c5)CC4)c(=O)ccn23)n(C)c1=O |
| InChI | InChI=1S/C25H29Cl2N7O3/c1-29-22-21(23(36)30(2)25(29)37)34-11-8-20(35)33(24(34)28-22)10-5-3-4-9-31-12-14-32(15-13-31)17-6-7-18(26)19(27)16-17/h6-8,11,16H,3-5,9-10,12-15H2,1-2H3 |
| InChIKey | KJYXIZKESDABBW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|