C29H44N6O3 — CID 70525913
7-[10-[4-(3-ethoxyphenyl)piperazin-1-yl]decyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 70525913) has the molecular formula C29H44N6O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 7-[10-[4-(3-ethoxyphenyl)piperazin-1-yl]decyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[10-[4-(3-ethoxyphenyl)piperazin-1-yl]decyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70525913 |
| Molecular Formula | C29H44N6O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | 7-[10-[4-(3-ethoxyphenyl)piperazin-1-yl]decyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCOc1cccc(N2CCN(CCCCCCCCCCn3cnc4c3c(=O)n(C)c(=O)n4C)CC2)c1 |
| InChI | InChI=1S/C29H44N6O3/c1-4-38-25-15-13-14-24(22-25)34-20-18-33(19-21-34)16-11-9-7-5-6-8-10-12-17-35-23-30-27-26(35)28(36)32(3)29(37)31(27)2/h13-15,22-23H,4-12,16-21H2,1-3H3 |
| InChIKey | WFMDFYDJYBHHSU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|