C19H24IN7O4 — CID 51042419
1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione;hydroiodide (PubChem CID 51042419) has the molecular formula C19H24IN7O4 and a molecular weight of 541.35 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione;hydroiodide.
| Compound Name | 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione;hydroiodide |
|---|---|
| PubChem CID | 51042419 |
| Molecular Formula | C19H24IN7O4 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 1,3-dimethyl-7-[2-[4-(4-nitrophenyl)piperazin-1-yl]ethyl]purine-2,6-dione;hydroiodide |
| SMILES | Cn1c(=O)c2c(ncn2CCN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(C)c1=O.I |
| InChI | InChI=1S/C19H23N7O4.HI/c1-21-17-16(18(27)22(2)19(21)28)25(13-20-17)12-9-23-7-10-24(11-8-23)14-3-5-15(6-4-14)26(29)30;/h3-6,13H,7-12H2,1-2H3;1H |
| InChIKey | ALFSAILJLQTQSF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|