C16H26N4O2 — CID 141409024
N,N-diethyl-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanamine (PubChem CID 141409024) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 141409024 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N,N-diethyl-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanamine |
| SMILES | CCN(CC)CCN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H26N4O2/c1-3-17(4-2)9-10-18-11-13-19(14-12-18)15-5-7-16(8-6-15)20(21)22/h5-8H,3-4,9-14H2,1-2H3 |
| InChIKey | QCSMCANFFABFKN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|