C15H22N4O3 — CID 2988792
N,N-diethyl-4-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 2988792) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N,N-diethyl-4-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2988792 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N,N-diethyl-4-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-3-16(4-2)15(20)18-11-9-17(10-12-18)13-5-7-14(8-6-13)19(21)22/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | GSPYNEMNYXNTSO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|