C14H22N4O4S — CID 31753109
N,N-diethyl-4-(4-nitrophenyl)piperazine-1-sulfonamide (PubChem CID 31753109) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is N,N-diethyl-4-(4-nitrophenyl)piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-(4-nitrophenyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 31753109 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N,N-diethyl-4-(4-nitrophenyl)piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H22N4O4S/c1-3-16(4-2)23(21,22)17-11-9-15(10-12-17)13-5-7-14(8-6-13)18(19)20/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | XJSLIHUIMPJELA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|