C17H26N4O4S — CID 25336331
1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)piperazine (PubChem CID 25336331) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 25336331 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)piperazine |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)C1 |
| InChI | InChI=1S/C17H26N4O4S/c1-14-11-15(2)13-20(12-14)26(24,25)19-9-7-18(8-10-19)16-3-5-17(6-4-16)21(22)23/h3-6,14-15H,7-13H2,1-2H3/t14-,15+ |
| InChIKey | UXJYSYCOXLYMTD-GASCZTMLSA-N |
| XLogP | 1.94 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|