C17H26N4O6S2 — CID 39977653
1-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine (PubChem CID 39977653) has the molecular formula C17H26N4O6S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine.
| Compound Name | 1-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 39977653 |
| Molecular Formula | C17H26N4O6S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonyl-4-(4-nitrophenyl)sulfonylpiperazine |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)C1 |
| InChI | InChI=1S/C17H26N4O6S2/c1-14-11-15(2)13-20(12-14)29(26,27)19-9-7-18(8-10-19)28(24,25)17-5-3-16(4-6-17)21(22)23/h3-6,14-15H,7-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | YHBLRTAOMGCUSQ-GJZGRUSLSA-N |
| XLogP | 1.12 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|