C28H32N6O13S4 — CID 102398687
9-(methylsulfanylmethoxymethyl)-1,4,7-tris[(4-nitrophenyl)sulfonyl]-1,4,7-triazecane (PubChem CID 102398687) has the molecular formula C28H32N6O13S4 and a molecular weight of 788.86 g/mol. Its IUPAC name is 9-(methylsulfanylmethoxymethyl)-1,4,7-tris[(4-nitrophenyl)sulfonyl]-1,4,7-triazecane.
| Compound Name | 9-(methylsulfanylmethoxymethyl)-1,4,7-tris[(4-nitrophenyl)sulfonyl]-1,4,7-triazecane |
|---|---|
| PubChem CID | 102398687 |
| Molecular Formula | C28H32N6O13S4 |
| Molecular Weight | 788.86 g/mol |
| Exact Mass | 788.09 |
| IUPAC Name | 9-(methylsulfanylmethoxymethyl)-1,4,7-tris[(4-nitrophenyl)sulfonyl]-1,4,7-triazecane |
| SMILES | CSCOCC1CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C28H32N6O13S4/c1-48-21-47-20-22-18-30(50(43,44)27-10-4-24(5-11-27)33(37)38)16-14-29(49(41,42)26-8-2-23(3-9-26)32(35)36)15-17-31(19-22)51(45,46)28-12-6-25(7-13-28)34(39)40/h2-13,22H,14-21H2,1H3 |
| InChIKey | QAJBRLKAVCGMJD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 250.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.86 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|