C15H17N3O7 — CID 68508509
2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]propanedioic acid (PubChem CID 68508509) has the molecular formula C15H17N3O7 and a molecular weight of 351.31 g/mol. Its IUPAC name is 2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]propanedioic acid.
| Compound Name | 2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]propanedioic acid |
|---|---|
| PubChem CID | 68508509 |
| Molecular Formula | C15H17N3O7 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]propanedioic acid |
| SMILES | O=C(O)C(CC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)C(=O)O |
| InChI | InChI=1S/C15H17N3O7/c19-13(9-12(14(20)21)15(22)23)17-7-5-16(6-8-17)10-1-3-11(4-2-10)18(24)25/h1-4,12H,5-9H2,(H,20,21)(H,22,23) |
| InChIKey | ARXZOZSAGSORQU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|