C18H26N4O5 — CID 10215842
N-hydroxy-8-[4-(4-nitrophenyl)piperazin-1-yl]-8-oxooctanamide (PubChem CID 10215842) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-hydroxy-8-[4-(4-nitrophenyl)piperazin-1-yl]-8-oxooctanamide.
| Compound Name | N-hydroxy-8-[4-(4-nitrophenyl)piperazin-1-yl]-8-oxooctanamide |
|---|---|
| PubChem CID | 10215842 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-hydroxy-8-[4-(4-nitrophenyl)piperazin-1-yl]-8-oxooctanamide |
| SMILES | O=C(CCCCCCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)NO |
| InChI | InChI=1S/C18H26N4O5/c23-17(19-25)5-3-1-2-4-6-18(24)21-13-11-20(12-14-21)15-7-9-16(10-8-15)22(26)27/h7-10,25H,1-6,11-14H2,(H,19,23) |
| InChIKey | HFVZTMQQAGRPBO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|