C23H29N5O4 — CID 5023525
1-[4-(4-hexanoylpiperazin-1-yl)phenyl]-3-(4-nitrophenyl)urea (PubChem CID 5023525) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[4-(4-hexanoylpiperazin-1-yl)phenyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[4-(4-hexanoylpiperazin-1-yl)phenyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 5023525 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-[4-(4-hexanoylpiperazin-1-yl)phenyl]-3-(4-nitrophenyl)urea |
| SMILES | CCCCCC(=O)N1CCN(c2ccc(NC(=O)Nc3ccc([N+](=O)[O-])cc3)cc2)CC1 |
| InChI | InChI=1S/C23H29N5O4/c1-2-3-4-5-22(29)27-16-14-26(15-17-27)20-10-6-18(7-11-20)24-23(30)25-19-8-12-21(13-9-19)28(31)32/h6-13H,2-5,14-17H2,1H3,(H2,24,25,30) |
| InChIKey | CVSSISFSKGZKPY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|