C18H26FN3O3 — CID 10126038
8-[4-(3-fluorophenyl)piperazin-1-yl]-N-hydroxy-8-oxooctanamide (PubChem CID 10126038) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 8-[4-(3-fluorophenyl)piperazin-1-yl]-N-hydroxy-8-oxooctanamide.
| Compound Name | 8-[4-(3-fluorophenyl)piperazin-1-yl]-N-hydroxy-8-oxooctanamide |
|---|---|
| PubChem CID | 10126038 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 8-[4-(3-fluorophenyl)piperazin-1-yl]-N-hydroxy-8-oxooctanamide |
| SMILES | O=C(CCCCCCC(=O)N1CCN(c2cccc(F)c2)CC1)NO |
| InChI | InChI=1S/C18H26FN3O3/c19-15-6-5-7-16(14-15)21-10-12-22(13-11-21)18(24)9-4-2-1-3-8-17(23)20-25/h5-7,14,25H,1-4,8-13H2,(H,20,23) |
| InChIKey | HKTHHZHPFRVBOC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|