C17H23FN4O3 — CID 113097711
N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N'-propan-2-yloxamide (PubChem CID 113097711) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N'-propan-2-yloxamide.
| Compound Name | N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 113097711 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCC(=O)N1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H23FN4O3/c1-12(2)20-17(25)16(24)19-11-15(23)22-8-6-21(7-9-22)14-5-3-4-13(18)10-14/h3-5,10,12H,6-9,11H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | KWXGYGXZQQHEKI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|