C16H22FN3O4S — CID 113097715
N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-propylsulfonylformamide (PubChem CID 113097715) has the molecular formula C16H22FN3O4S and a molecular weight of 371.43 g/mol. Its IUPAC name is N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-propylsulfonylformamide.
| Compound Name | N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-propylsulfonylformamide |
|---|---|
| PubChem CID | 113097715 |
| Molecular Formula | C16H22FN3O4S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2-[4-(3-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-propylsulfonylformamide |
| SMILES | CCCS(=O)(=O)C(=O)NCC(=O)N1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H22FN3O4S/c1-2-10-25(23,24)16(22)18-12-15(21)20-8-6-19(7-9-20)14-5-3-4-13(17)11-14/h3-5,11H,2,6-10,12H2,1H3,(H,18,22) |
| InChIKey | WAUNEJDVXLFGIN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|