C14H20N6O3 — CID 56809659
1,3-dimethyl-7-[2-(5-oxo-1,4-diazepan-1-yl)ethyl]purine-2,6-dione (PubChem CID 56809659) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-(5-oxo-1,4-diazepan-1-yl)ethyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-(5-oxo-1,4-diazepan-1-yl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 56809659 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1,3-dimethyl-7-[2-(5-oxo-1,4-diazepan-1-yl)ethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCN2CCNC(=O)CC2)n(C)c1=O |
| InChI | InChI=1S/C14H20N6O3/c1-17-12-11(13(22)18(2)14(17)23)20(9-16-12)8-7-19-5-3-10(21)15-4-6-19/h9H,3-8H2,1-2H3,(H,15,21) |
| InChIKey | LLDIYQNWLHADLD-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |