C11H18N4O2 — CID 145188731
ethane;7-ethyl-1,3-dimethylpurine-2,6-dione (PubChem CID 145188731) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is ethane;7-ethyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | ethane;7-ethyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 145188731 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | ethane;7-ethyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CC.CCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C9H12N4O2.C2H6/c1-4-13-5-10-7-6(13)8(14)12(3)9(15)11(7)2;1-2/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | BEDOASAJPYJOPI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |