C13H22IN5O2 — CID 110175939
1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl-trimethylazanium iodide (PubChem CID 110175939) has the molecular formula C13H22IN5O2 and a molecular weight of 407.26 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl-trimethylazanium iodide.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl-trimethylazanium iodide |
|---|---|
| PubChem CID | 110175939 |
| Molecular Formula | C13H22IN5O2 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopurin-7-yl)propan-2-yl-trimethylazanium iodide |
| SMILES | CC(Cn1cnc2c1c(=O)n(C)c(=O)n2C)[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C13H22N5O2.HI/c1-9(18(4,5)6)7-17-8-14-11-10(17)12(19)16(3)13(20)15(11)2;/h8-9H,7H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | ZKKWTDHJBCWOBI-UHFFFAOYSA-M |
| XLogP | -3.47 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|