C14H22N4O2 — CID 13277161
1-methyl-3,7-bis(2-methylpropyl)purine-2,6-dione (PubChem CID 13277161) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-methyl-3,7-bis(2-methylpropyl)purine-2,6-dione.
| Compound Name | 1-methyl-3,7-bis(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 13277161 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-methyl-3,7-bis(2-methylpropyl)purine-2,6-dione |
| SMILES | CC(C)Cn1cnc2c1c(=O)n(C)c(=O)n2CC(C)C |
| InChI | InChI=1S/C14H22N4O2/c1-9(2)6-17-8-15-12-11(17)13(19)16(5)14(20)18(12)7-10(3)4/h8-10H,6-7H2,1-5H3 |
| InChIKey | MJMVZBRCBZFOTE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |